|
|
| | Rotigotine Impurity 19 (Rotigotine EP Impurity F) Basic information |
| Product Name: | Rotigotine Impurity 19 (Rotigotine EP Impurity F) | | Synonyms: | Rotigotine Impurity 19 (Rotigotine EP Impurity F);1-Naphthalenol, 5,6,7,8-tetrahydro-6-[propyl[2-(2-thienyl)ethyl]amino]-, 1-acetate, (6S)-;Rotigotine Impurity 18;1-Naphthalenol, 5,6,7,8-tetrahydro-6-[propyl[2-(2-thienyl)ethyl]amino]-,acetate (ester), (6S)-;Acetyl RotigotineQ: What is
Acetyl Rotigotine Q: What is the CAS Number of
Acetyl Rotigotine;5-methyloxadiazole-4-carboxylic acid;Rotigotine Impurity 19;Rotigotine EP Impurity F HCl | | CAS: | 835654-68-7 | | MF: | C21H27NO2S | | MW: | 357.51 | | EINECS: | | | Product Categories: | | | Mol File: | 835654-68-7.mol |  |
| | Rotigotine Impurity 19 (Rotigotine EP Impurity F) Chemical Properties |
| Boiling point | 498.3±45.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | pka | 8.76±0.20(Predicted) | | InChI | InChI=1S/C21H27NO2S/c1-3-12-22(13-11-19-7-5-14-25-19)18-9-10-20-17(15-18)6-4-8-21(20)24-16(2)23/h4-8,14,18H,3,9-13,15H2,1-2H3/t18-/m0/s1 | | InChIKey | DSYJRJFDFYEVFD-SFHVURJKSA-N | | SMILES | C1(OC(=O)C)=C2C(C[C@@H](N(CCC)CCC3SC=CC=3)CC2)=CC=C1 |
| | Rotigotine Impurity 19 (Rotigotine EP Impurity F) Usage And Synthesis |
| Uses | O-Acetylrotigotine is an impurity of Rotigotine , which is a non-ergolinic dopamine agonist used in the treatment of Parkinson's disorder and restless legs syndrome. |
| | Rotigotine Impurity 19 (Rotigotine EP Impurity F) Preparation Products And Raw materials |
|