| Company Name: |
Jiangsu Watson Bio Ltd Gold
|
| Tel: |
0512-81863996 13773182657; |
| Email: |
sales@watson.bio |
| Products Intro: |
Product Name:DCPMA//2-Propenoic acid, 2-methyl-, 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-yl ester
CAS:46502-72-1
Purity:97% Package:1kg,10kg
|
|
| | 2-Propenoic acid, 2-methyl-, 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-yl ester Basic information |
| Product Name: | 2-Propenoic acid, 2-methyl-, 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-yl ester | | Synonyms: | 2-Propenoic acid, 2-methyl-, 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-yl ester;DCPMA//2-Propenoic acid, 2-methyl-, 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-yl ester | | CAS: | 46502-72-1 | | MF: | C14H18O2 | | MW: | 218.29 | | EINECS: | | | Product Categories: | | | Mol File: | 46502-72-1.mol |  |
| | 2-Propenoic acid, 2-methyl-, 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-yl ester Chemical Properties |
| Boiling point | 145-150 °C(Press: 2 Torr) | | density | 1.0856 g/cm3 | | InChI | InChI=1S/C14H18O2/c1-8(2)14(15)16-13-7-9-6-12(13)11-5-3-4-10(9)11/h3-4,9-13H,1,5-7H2,2H3 | | InChIKey | PXPQLEHKQLUZLY-UHFFFAOYSA-N | | SMILES | C(OC1C2CC(C1)C1C2CC=C1)(=O)C(C)=C |
| | 2-Propenoic acid, 2-methyl-, 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-yl ester Usage And Synthesis |
| | 2-Propenoic acid, 2-methyl-, 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-6-yl ester Preparation Products And Raw materials |
|