| Company Name: |
Cool Pharm, Ltd Gold |
| Tel: |
021-58581007 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | 3-Oxetanecarboxylic acid Basic information |
| Product Name: | 3-Oxetanecarboxylic acid | | Synonyms: | Oxetane-3-carboxylicacid,95%;Oxetane-3-carboxylicaci;3-Oxetanecarboxylic acid (9CI, ACI);Oxetane-3-carboxylic acid - [X6122];3-Oxetanecarboxylic acid | | CAS: | 114012-41-8 | | MF: | C4H6O3 | | MW: | 102.09 | | EINECS: | | | Product Categories: | | | Mol File: | 114012-41-8.mol |  |
| | 3-Oxetanecarboxylic acid Chemical Properties |
| Boiling point | 244℃ | | density | 1.374 | | refractive index | 1.492 | | Fp | 115°(239°F) | | storage temp. | -20°C | | pka | 3.88±0.20(Predicted) | | form | liquid | | Appearance | white to yellow oil or semi-solid | | Water Solubility | Slightly soluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C4H6O3/c5-4(6)3-1-7-2-3/h3H,1-2H2,(H,5,6) | | InChIKey | UWOTZNQZPLAURK-UHFFFAOYSA-N | | SMILES | O1CC(C(O)=O)C1 | | CAS DataBase Reference | 114012-41-8 |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 29329990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | 3-Oxetanecarboxylic acid Usage And Synthesis |
| Uses | Oxetane-3-carboxylic acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals and agrochemicals. | | Synthesis | 3-Oxetanecarboxylic acid was prepared from methyl 3-hydroxy-2-(hydroxymethyl)propionate by protecting group, ring closure and hydrolysis. |
| | 3-Oxetanecarboxylic acid Preparation Products And Raw materials |
|