| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Dehydronitrendipine
CAS:89267-41-4
Package:100Mg,10Mg
|
|
| | Dehydronitrendipine Basic information |
| Product Name: | Dehydronitrendipine | | Synonyms: | 2,6-DIMETHYL-4-(3-NITRO-PHENYL)-PYRIDINE-3,5-DICARBOXYLIC ACID 3-ETHYL ESTER 5-METHYL ESTER;BAY-m 4786;Dehydronitrendipine;Ethyl methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate;2,6-Dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid, ethyl methyl ester, hydrochloride;3-O-ethyl 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate;Nitrendipine Impurit Ⅰ: 2,6-Dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic Acid Ethyl Methyl Ester(Dehydronitrendipine);2,6-Dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid ethyl methyl ester | | CAS: | 89267-41-4 | | MF: | C18H18N2O6 | | MW: | 358.35 | | EINECS: | | | Product Categories: | Amines, Aromatics, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 89267-41-4.mol |  |
| | Dehydronitrendipine Chemical Properties |
| Melting point | 59-61℃ | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C18H18N2O6/c1-5-26-18(22)15-11(3)19-10(2)14(17(21)25-4)16(15)12-7-6-8-13(9-12)20(23)24/h6-9H,5H2,1-4H3 | | InChIKey | YEHVABIPGJLMET-UHFFFAOYSA-N | | SMILES | [N+](=O)([O-])c1cc(ccc1)c2c(c(nc(c2C(=O)OC)C)C)C(=O)OCC |
| | Dehydronitrendipine Usage And Synthesis |
| Uses | Dehydronitrendipine is a derivative of Nitrendipine (N490150), a dihydropyridine calcium channel blocker. Nitrendipine is used in the treatment of primary (essential) hypertension to decrease blood pressure. Antihypertensive. |
| | Dehydronitrendipine Preparation Products And Raw materials |
|