|
|
| | Sodium 3,5,6-trichloropyridin-2-olate Basic information |
| Product Name: | Sodium 3,5,6-trichloropyridin-2-olate | | Synonyms: | SODIUM 3,5,6-TRICHLORO-2-PYRIDINOL;Sodium 3,5,6-trichloropyridin-2-olate;3,5,6-TRICHLOROPYRIDIN-2-OL SODIUM;3,5,6-trichloro-2(1h)-pyridinone sodium salt;3,5,6-TRICHLORO-2-PYRIDINOL SODIUM SALT;3,5,6-Trichloro-Pyridine-2-Ol Sodium Salt;2-HYDOXY-3,5,6-TRICHLOROPYRIDINE;SODIUMTRICHLOROPYRIDINOL | | CAS: | 37439-34-2 | | MF: | C5H3Cl3NNaO | | MW: | 222.42 | | EINECS: | 253-506-0 | | Product Categories: | bc0001 | | Mol File: | 37439-34-2.mol |  |
| | Sodium 3,5,6-trichloropyridin-2-olate Chemical Properties |
| density | 1426[at 20℃] | | vapor pressure | 0Pa at 25℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | Methanol (Slightly) | | form | Solid | | color | White | | Water Solubility | 2.5g/L at 20℃ | | InChI | InChI=1S/C5H2Cl3NO.Na.H/c6-2-1-3(7)5(10)9-4(2)8;;/h1H,(H,9,10);; | | InChIKey | KBLLFLJKHHNYCS-UHFFFAOYSA-N | | SMILES | ClC1C=C(Cl)C(=O)NC=1Cl.[NaH] | | LogP | -0.64 at 22.4℃ | | CAS DataBase Reference | 37439-34-2(CAS DataBase Reference) | | EPA Substance Registry System | 2(1H)-Pyridinone, 3,5,6-trichloro-, sodium salt (37439-34-2) |
| | Sodium 3,5,6-trichloropyridin-2-olate Usage And Synthesis |
| Uses | Sodium 3,5,6-trichloro-2-pyridinol is an intermediate in synthesizing Chlorpyrifos (Diethyl-d10) (C425302), which is derived from 3,5,6-Trichloro-2-pyridinol (T773860), a metabolite of Chlorpyrifos (C425300). Used as a standard for Pesticide detection. | | Flammability and Explosibility | Non flammable |
| | Sodium 3,5,6-trichloropyridin-2-olate Preparation Products And Raw materials |
|