|
|
| | tert-Amyl perpivalate Basic information |
| Product Name: | tert-Amyl perpivalate | | Synonyms: | tert-Amyl perpivalate;tert-Amyl perxypivalate(in solution,content≤77%);tert-Amyl peroxypivalate;tert-pentyl peroxypivalate;Propaneperoxoic acid, 2,2-dimethyl-, 1,1-dimethylpropyl ester;tert.-Amylperoxypivalat21;2,2-Dimethylperoxypropionic acid 1,1-dimethylpropyl ester;2,2-Dimethylperoxypropionic acid tert-amyl ester | | CAS: | 29240-17-3 | | MF: | C10H20O3 | | MW: | 188.26 | | EINECS: | 249-530-6 | | Product Categories: | | | Mol File: | 29240-17-3.mol |  |
| | tert-Amyl perpivalate Chemical Properties |
| Boiling point | 204.0±23.0 °C(Predicted) | | density | 0.924±0.06 g/cm3(Predicted) | | vapor pressure | 14Pa at 35℃ | | Water Solubility | 504mg/L at 20℃ | | InChI | InChI=1S/C10H20O3/c1-7-10(5,6)13-12-8(11)9(2,3)4/h7H2,1-6H3 | | InChIKey | AQKYLAIZOGOPAW-UHFFFAOYSA-N | | SMILES | C(OOC(C)(C)CC)(=O)C(C)(C)C | | LogP | 3.3 at 30℃ | | EPA Substance Registry System | Propaneperoxoic acid, 2,2-dimethyl-, 1,1-dimethylpropyl ester (29240-17-3) |
| RIDADR | 3113 | | TSCA | TSCA listed | | HazardClass | 5.2 | | PackingGroup | II |
| | tert-Amyl perpivalate Usage And Synthesis |
| Chemical Properties | t-Amyl peroxypivalate is a colorless to slightly yellowliquid.
It has an active oxygen content of 6.29–6.46% at 74–76%
purity. In benzene at 0.2 mol/L, it has a half-life of 10.0 h at
58°C (137°F). It is soluble in most organic solvents and is
used as a low-temperature initiator for the polymerization of
ethylene, vinyl chloride, vinyl acetate, styrene, acrylonitrile,
and methyl methacrylate . | | Flammability and Explosibility | Not classified |
| | tert-Amyl perpivalate Preparation Products And Raw materials |
|