- Cichoric acid
-
-
2026-04-27
- CAS:70831-56-0
- Min. Order:
- Purity: 0.99
- Supply Ability:
- L-Chicoric Acid
-
- $56.00 / 5mg
-
2026-04-22
- CAS:70831-56-0
- Min. Order:
- Purity: 99.00%
- Supply Ability: 10g
|
| | Cichoric acid Basic information |
| | Cichoric acid Chemical Properties |
| Melting point | 206°C(lit.) | | Boiling point | 46-47 °C | | density | 1.641±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMSO: 100 mg/mL (210.81 mM) | | form | powder to crystal | | pka | 1.42±0.25(Predicted) | | color | White to Light yellow to Light orange | | λmax | 327nm(lit.) | | Major Application | food and beverages | | InChIKey | YDDGKXBLOXEEMN-IABMMNSOSA-N | | SMILES | C(O)(=O)[C@H](OC(=O)/C=C/C1=CC=C(O)C(O)=C1)[C@@H](OC(=O)/C=C/C1=CC=C(O)C(O)=C1)C(O)=O | | CAS DataBase Reference | 70831-56-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-42/43 | | Safety Statements | 22-36/37-45-24/25 | | WGK Germany | 3 | | RTECS | EJ9852090 | | HS Code | 29182900 | | Storage Class | 11 - Combustible Solids |
| | Cichoric acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | food and beverages | | Definition | ChEBI: Chicoric acid is an organooxygen compound. It has a role as a HIV-1 integrase inhibitor and a geroprotector. It is functionally related to a tetracarboxylic acid. | | IC 50 | HIV-1 |
| | Cichoric acid Preparation Products And Raw materials |
|