Benzoic acid, 2,4-dimethoxy-, 4-[(4-nitrophenoxy)carbonyl]phenyl ester manufacturers
|
| | Benzoic acid, 2,4-dimethoxy-, 4-[(4-nitrophenoxy)carbonyl]phenyl ester Basic information |
| Product Name: | Benzoic acid, 2,4-dimethoxy-, 4-[(4-nitrophenoxy)carbonyl]phenyl ester | | Synonyms: | Benzoic acid, 2,4-dimethoxy-, 4-[(4-nitrophenoxy)carbonyl]phenyl ester;4-((4-Nitrophenoxy)carbonyl)phenyl 2,4-dimethoxybenzoate;Benzoic acid, 2,4-dimethoxy-, 4-[(4-nitrophenoxy)carbonyl]phenyl este;Benzoic acid, 4-methoxy-2-(1-methylethoxy)-, 4-[(4-nitrophenoxy)carbonyl]phenyl ester;4-[(4-Nitrophenoxy)carbonyl]phenyl 2,4-dimethoxybenzoate(RM 734) | | CAS: | 2196195-87-4 | | MF: | C22H17NO8 | | MW: | 423.37 | | EINECS: | | | Product Categories: | | | Mol File: | 2196195-87-4.mol | ![Benzoic acid, 2,4-dimethoxy-, 4-[(4-nitrophenoxy)carbonyl]phenyl ester Structure](CAS/20210305/GIF/2196195-87-4.gif) |
| | Benzoic acid, 2,4-dimethoxy-, 4-[(4-nitrophenoxy)carbonyl]phenyl ester Chemical Properties |
| Boiling point | 623.2±55.0 °C(Predicted) | | density | 1.339±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C22H17NO8/c1-28-18-11-12-19(20(13-18)29-2)22(25)31-16-7-3-14(4-8-16)21(24)30-17-9-5-15(6-10-17)23(26)27/h3-13H,1-2H3 | | InChIKey | GTOBZXOWFFWRDY-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(C(OC2=CC=C([N+]([O-])=O)C=C2)=O)C=C1)(=O)C1=CC=C(OC)C=C1OC |
| | Benzoic acid, 2,4-dimethoxy-, 4-[(4-nitrophenoxy)carbonyl]phenyl ester Usage And Synthesis |
| | Benzoic acid, 2,4-dimethoxy-, 4-[(4-nitrophenoxy)carbonyl]phenyl ester Preparation Products And Raw materials |
|