- [(difluoromethyl)thio]benzene
-
- $30.00 / 1kg
-
2025-09-25
- CAS:1535-67-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | [(difluoromethyl)thio]benzene Basic information | | Uses |
| Product Name: | [(difluoromethyl)thio]benzene | | Synonyms: | [(difluoromethyl)thio]benzene;Phenyl difluoromethyl sulfide;Benzene, [(difluoroMethyl)thio]-;Difluoromethyl Phenyl Sulfide;(difluoromethyl)(phenyl)sulfane;[(difluoromethyl)sulfanyl]benzene;alpha,alpha-Difluorothioanisole | | CAS: | 1535-67-7 | | MF: | C7H6F2S | | MW: | 160.18 | | EINECS: | 216-255-8 | | Product Categories: | | | Mol File: | 1535-67-7.mol | ![[(difluoromethyl)thio]benzene Structure](CAS/GIF/1535-67-7.gif) |
| | [(difluoromethyl)thio]benzene Chemical Properties |
| Boiling point | 63°C/7mmHg(lit.) | | density | 1.21±0.1 g/cm3(Predicted) | | refractive index | 1.5090 to 1.5130 | | storage temp. | Storage temp. 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C7H6F2S/c8-7(9)10-6-4-2-1-3-5-6/h1-5,7H | | InChIKey | KDNBCPHMQJEQLV-UHFFFAOYSA-N | | SMILES | C1(SC(F)F)=CC=CC=C1 |
| RIDADR | UN 1993 3/PG III | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2930909899 |
| | [(difluoromethyl)thio]benzene Usage And Synthesis |
| Uses | Difluoromethyl phenyl sulfide is an ether derivative that can be used as a biochemical reagent. |
| | [(difluoromethyl)thio]benzene Preparation Products And Raw materials |
|