|
|
| | 2-Hydroxyethyl methacrylate phosphate Basic information | | Preparation |
| Product Name: | 2-Hydroxyethyl methacrylate phosphate | | Synonyms: | 2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester, phosphate;2-hydroxyethyl methacrylate phosphate;2-Hydroxyethyl 2-methyl-2-propenoate, phosphate;2-Hydroxyethyl methacrylate acid phosphate;JPA-514;Phosphoric acid 2-hydroxyethyl Methacrylate ester contains 700-1000 ppM MonoMethyl ether hydroquinone, 90%;Hydroxyethyl methacrylate, phosphated;Hydroxyethyl methacrylate,phosphated | | CAS: | 52628-03-2 | | MF: | C6H13O7P | | MW: | 228.14 | | EINECS: | 258-053-2 | | Product Categories: | Acrylic Monomers;Methacrylate;Monomers | | Mol File: | 52628-03-2.mol |  |
| | 2-Hydroxyethyl methacrylate phosphate Chemical Properties |
| Boiling point | 129.7℃[at 101 325 Pa] | | density | 1.37 g/mL at 25 °C | | vapor pressure | 10.11hPa at 20℃ | | refractive index | n20/D 1.4688 | | Fp | 145 °C | | storage temp. | 2-8°C | | form | liquid | | Water Solubility | 25g/L at 25℃ | | Cosmetics Ingredients Functions | NAIL CONDITIONING | | InChI | InChI=1S/C6H10O3.H3O4P/c1-5(2)6(8)9-4-3-7;1-5(2,3)4/h7H,1,3-4H2,2H3;(H3,1,2,3,4) | | InChIKey | POLZHVHESHDZRD-UHFFFAOYSA-N | | SMILES | C(=O)(OCCO)C(=C)C.P(O)(O)(O)=O | | LogP | 2.72 at 30℃ | | EPA Substance Registry System | 2-Hydroxyethyl methacrylate phosphate (52628-03-2) |
| Hazard Codes | C | | Risk Statements | 22-34-37 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Met. Corr. 1
Skin Corr. 1B
STOT SE 3 |
| | 2-Hydroxyethyl methacrylate phosphate Usage And Synthesis |
| Preparation | 2-Hydroxyethyl methacrylate phosphate can be prepared by reacting hydroxyethyl methacrylate (HEMA) with P2O5 and using highly catalytic POMs ([TEAH]3PW12O40 and H3PW12O40) as catalysts. | | Uses | Phosphoric acid 2-hydroxyethyl methacrylate ester is used in surface functionalization of polytetrafluoroethylene (PTFE) for craniofacial applications. | | General Description | Phosphoric acid 2-hydroxyethyl methacrylate ester is a phosphoric acid based ester which is composed of phosphoric acid monomer and diethyl methacrylate. It can be used as a chelating absorbent due to its high affinity towards metal ions. | | Flammability and Explosibility | Highly flammable |
| | 2-Hydroxyethyl methacrylate phosphate Preparation Products And Raw materials |
|