| Company Name: |
Hangzhou Paramount Product Corporation Gold
|
| Tel: |
0571-56076803 18667038366 |
| Email: |
info@paramountproduct.com |
| Products Intro: |
Product Name:DISPERSE BROWN 27 CAS:63741-10-6 Package:5KG;25KG
|
N-(2-chloroethyl)-4-[(2,6-dichloro-4-nitrophenyl)azo]-N-ethyl-m-toluidine manufacturers
|
| | N-(2-chloroethyl)-4-[(2,6-dichloro-4-nitrophenyl)azo]-N-ethyl-m-toluidine Basic information |
| | N-(2-chloroethyl)-4-[(2,6-dichloro-4-nitrophenyl)azo]-N-ethyl-m-toluidine Chemical Properties |
| Boiling point | 573.9±50.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | pka | 2.46±0.50(Predicted) | | Water Solubility | 7.41μg/L at 20℃ | | InChI | InChI=1S/C17H17Cl3N4O2/c1-3-23(7-6-18)12-4-5-16(11(2)8-12)21-22-17-14(19)9-13(24(25)26)10-15(17)20/h4-5,8-10H,3,6-7H2,1-2H3 | | InChIKey | UGDJBKWHSWJSMB-UHFFFAOYSA-N | | SMILES | C1(N(CCCl)CC)=CC=C(N=NC2=C(Cl)C=C([N+]([O-])=O)C=C2Cl)C(C)=C1 | | LogP | 7.2 at 35℃ | | EPA Substance Registry System | Benzenamine, N-(2-chloroethyl)-4-[(2,6-dichloro-4-nitrophenyl)azo]-N-ethyl-3-methyl- (63741-10-6) |
| | N-(2-chloroethyl)-4-[(2,6-dichloro-4-nitrophenyl)azo]-N-ethyl-m-toluidine Usage And Synthesis |
| Uses | N-(2-chloroethyl)-4-[(2,6-dichloro-4-nitrophenyl)azo]-N-ethyl-m-toluidine is a useful research chemical. | | Flammability and Explosibility | Not classified |
| | N-(2-chloroethyl)-4-[(2,6-dichloro-4-nitrophenyl)azo]-N-ethyl-m-toluidine Preparation Products And Raw materials |
|