|
|
| | 2-Chloro-3-oxopropionic acid ethyl ester Basic information |
| Product Name: | 2-Chloro-3-oxopropionic acid ethyl ester | | Synonyms: | 2-Chloro-3-oxopropanoic acid ethyl ester;2-Chloro-3-oxopropionic acid ethyl ester;Ethyl 2-Chloro-3-oxopropanoate;Ethyl α-ForMyl-α-chloroacetate;Ethyl 2-chloro-2-formylethanoate, Ethyl 2-chloro-3-oxopropionate;Ethyl 2-chloro-3-oxopropanoate, tech;2-chloro-3-oxopropanoate;Ethyl chloroMalonaldehydate | | CAS: | 33142-21-1 | | MF: | C5H7ClO3 | | MW: | 150.56 | | EINECS: | 251-390-6 | | Product Categories: | Miscellaneous Reagents | | Mol File: | 33142-21-1.mol |  |
| | 2-Chloro-3-oxopropionic acid ethyl ester Chemical Properties |
| Melting point | 88-90 °C(Solv: benzene (71-43-2)) | | Boiling point | 68-70 °C(Press: 20 Torr) | | density | 1.217±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | soluble in Chloroform, Dichloromethane | | pka | 4.09±0.29(Predicted) | | form | low melting solid | | Appearance | White to off-white Solid | | Stability: | Store FROZEN | | InChI | InChI=1S/C5H7ClO3/c1-2-9-5(8)4(6)3-7/h3-4H,2H2,1H3 | | InChIKey | DWXKSCKBUSAOKS-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(Cl)C=O | | CAS DataBase Reference | 33142-21-1 |
| | 2-Chloro-3-oxopropionic acid ethyl ester Usage And Synthesis |
| Chemical Properties | Thick Oil | | Uses | Material that was assayed to be approximately 80% pure was diluted to 5% in benzene. |
| | 2-Chloro-3-oxopropionic acid ethyl ester Preparation Products And Raw materials |
|