isobutyl hydrogen phthalate manufacturers
|
| | isobutyl hydrogen phthalate Basic information |
| Product Name: | isobutyl hydrogen phthalate | | Synonyms: | 1,2-Benzenedicarboxylic Acid 1-(2-Methylpropyl) Ester;isobutyl hydrogen phthalate;2-(2-methylpropoxycarbonyl)benzoic acid;MONOISOBUTYLPHTHALATE;Phthalic acid 1-isobutyl ester;Phthalic acid hydrogen 1-isobutyl ester;1,2-Benzenedicarboxylic acid, mono(2-methylpropyl) ester;Brn 3280781 | | CAS: | 30833-53-5 | | MF: | C12H14O4 | | MW: | 222.23716 | | EINECS: | 2503526 | | Product Categories: | Aromatics;Metabolites & Impurities | | Mol File: | 30833-53-5.mol |  |
| | isobutyl hydrogen phthalate Chemical Properties |
| Melting point | 78-80°C | | Boiling point | 283.41°C (rough estimate) | | density | 1.0643 (rough estimate) | | refractive index | 1.4560 (estimate) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 3.37±0.36(Predicted) | | form | Solid | | color | White | | biological source | synthetic | | InChI | 1S/C12H14O4/c1-8(2)7-16-12(15)10-6-4-3-5-9(10)11(13)14/h3-6,8H,7H2,1-2H3,(H,13,14) | | InChIKey | RZJSUWQGFCHNFS-UHFFFAOYSA-N | | SMILES | O(CC(C)C)C(=O)c1c(cccc1)C(=O)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | isobutyl hydrogen phthalate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Phthalate metabolite. | | Definition | ChEBI: A phthalic acid monoester obtained by formal condensation of one of the carboxy groups of phthalic acid with the hydroxy group of isobutanol. | | IC 50 | Human Endogenous Metabolite |
| | isobutyl hydrogen phthalate Preparation Products And Raw materials |
|