|
|
| | sulfiram Basic information |
| Product Name: | sulfiram | | Synonyms: | sulfiram;Tetraethylthiuram monosulfide;TETRAETHYLTHIURAMMONOSULPHIDE;Thiodicarbonic diamide ((H2N)C(S)2S), tetraethyl-;BIS(DIETHYLTHIOCARBAMOYL)SULPHIDE;Tetmos;diethylcarbamothioyl N,N-diethylcarbamodithioate;N,N-diethylcarbamodithioic acid diethylthiocarbamoyl ester | | CAS: | 95-05-6 | | MF: | C10H20N2S3 | | MW: | 264.4742 | | EINECS: | 2023873 | | Product Categories: | Agro-Products;Amines;Sulfur & Selenium Compounds | | Mol File: | 95-05-6.mol |  |
| | sulfiram Chemical Properties |
| Melting point | 30-32° | | density | 1.1200 | | refractive index | 1.5500 (rough estimate) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Low-Melting Solid | | color | Light Yellow to Yellow | | Stability: | Light Sensitive | | Major Application | pharmaceutical
pharmaceutical small molecule | | InChI | InChI=1S/C10H20N2S3/c1-5-11(6-2)9(13)15-10(14)12(7-3)8-4/h5-8H2,1-4H3 | | InChIKey | CTPKSRZFJSJGML-UHFFFAOYSA-N | | SMILES | N(CC)(CC)C(=S)SC(=S)N(CC)CC | | CAS DataBase Reference | 95-05-6 | | EPA Substance Registry System | Thiodicarbonic diamide ([(H2N)C(S)]2S), tetraethyl- (95-05-6) |
| RIDADR | 2811 | | WGK Germany | WGK 3 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
STOT RE 2 |
| | sulfiram Usage And Synthesis |
| Chemical Properties | Yellow Low Melting Solid | | Uses | As vulcanization agent. | | Uses | sulfiram acts as a vulcanization agent,it is used in combination pesticide compositions for controlling infestation. | | Definition | ChEBI: Sulfiram is an organosulfur compound. | | Contact allergens | This rubber vulcanization accelerator is also used as an ectoparasiticide against Sarcoptes scabiei, louses, or in veterinary medicine. |
| | sulfiram Preparation Products And Raw materials |
|