|
|
| | N-(3-aminopropyl)-N-dodecylpropane-1,3-diamine Basic information |
| Product Name: | N-(3-aminopropyl)-N-dodecylpropane-1,3-diamine | | Synonyms: | 1,3-Propanediamine, N-(3-aminopropyl)-N-dodecyl-;LONZABAC12.100;N-3-AMINOPROPYL-N-DODECYL-1,3-PROPANEDIAMINE;N-(3-Aminopropyl)-N-dodecylpropan-1,3-diamin;3-Propanediamine, N-(3-aminopropyl)-N-dodecyl-1;N,N-Bis-(3-aminopropyl)-laurylamine;Lonzabac(R) 12.100;N-(3-Aminopropyl)-N-dodecylpropane-1,3-diamine (100%) | | CAS: | 2372-82-9 | | MF: | C18H41N3 | | MW: | 299.54 | | EINECS: | 219-145-8 | | Product Categories: | 2372-82-9 | | Mol File: | 2372-82-9.mol |  |
| | N-(3-aminopropyl)-N-dodecylpropane-1,3-diamine Chemical Properties |
| Boiling point | 182-184 °C(Press: 1 Torr) | | density | 0.880 | | vapor pressure | 0Pa at 25℃ | | solubility | 560g/L in organic solvents at 20 ℃ | | pka | 10.46±0.10(Predicted) | | form | Oil | | color | Colourless | | Water Solubility | 190g/L at 20℃ | | Cosmetics Ingredients Functions | HAIR CONDITIONING VISCOSITY CONTROLLING | | InChI | InChI=1S/C18H41N3/c1-2-3-4-5-6-7-8-9-10-11-16-21(17-12-14-19)18-13-15-20/h2-20H2,1H3 | | InChIKey | NYNKJVPRTLBJNQ-UHFFFAOYSA-N | | SMILES | C(N(CCCN)CCCCCCCCCCCC)CCN | | LogP | 0.34 at 20℃ | | CAS DataBase Reference | 2372-82-9 | | EPA Substance Registry System | 1,3-Propanediamine, N-(3-aminopropyl)-N-dodecyl- (2372-82-9) |
| RIDADR | 2735 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III |
| | N-(3-aminopropyl)-N-dodecylpropane-1,3-diamine Usage And Synthesis |
| Description | N-(3-Aminopropyl)-n-dodecylpropane-1,3-diamine, also called N,N-bis(3-aminopropyl)dodecylamine and laurylamine dipropylenediamine, is dodecylamine substituted with 2 propylamine units. Laurylamine dipropylenediamine is a non-ionic surfactant, antimicrobial agent, preservative, emulsifying agent, dispersing agent, corrosion inhibitor and an anti-static agent used in hair products. | | Chemical Properties | Liquid | | Uses | Lonzabac(R) 12.30 is used as disinfectant for food processing industry, institutions, hospitals (surfaces and instruments).. | | Uses | N-(3-aminopropyl)-N-dodecylpropane-1,3-diamine is used as disinfectant for food processing industry, institutions, hospitals (surfaces and instruments).N-(3-Aminopropyl)-n-dodecylpropane-1,3-diamine is a reactant used in the synthesis of gluconamide derivatives as cationic surfactants with antimicrobial properties. | | Contact allergens | This alkylamine is contained in detergent-disinfectants
solutions for medical instruments. It is also contained
in association with 3-aminopropyl dodecylamine in
liquid laundry disinfectants such as Aset aqua (Johnson
Wax SpA, Rydelle). |
| | N-(3-aminopropyl)-N-dodecylpropane-1,3-diamine Preparation Products And Raw materials |
|