perhydroacenaphthene manufacturers
|
| | perhydroacenaphthene Basic information |
| Product Name: | perhydroacenaphthene | | Synonyms: | Perhydroacenaphthene 2146-36-3 Decahydroacenaphthene;perhydroacephthene;perhydroacenaphthene;Decahydroacenaphthene;Tricyclo(6,3,1,04,12)dodecane;Dodecahydroacenaphthylene;Tricyclo[7.2.1.05,12]dodecane;Acenaphthylene, dodecahydro- | | CAS: | 2146-36-3 | | MF: | C12H20 | | MW: | 164.29 | | EINECS: | 218-412-6 | | Product Categories: | | | Mol File: | 2146-36-3.mol |  |
| | perhydroacenaphthene Chemical Properties |
| Melting point | 36℃ | | Boiling point | 235℃ | | density | 1.029 g/cm3 | | refractive index | 1.577 (589.3 nm 20℃) | | storage temp. | 2-8°C | | form | Liquid | | color | Yellowish brown | | InChI | InChI=1S/C12H20/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h9-12H,1-8H2 | | InChIKey | FZDZWLDRELLWNN-UHFFFAOYSA-N | | SMILES | C1C2C3C(CCC2)CCCC3C1 | | EPA Substance Registry System | Acenaphthylene, dodecahydro- (2146-36-3) |
| | perhydroacenaphthene Usage And Synthesis |
| Uses | Perhydroacenaphthene or dodecahydroacenaphthylene is used in the synthesis of Alkyladamantanes by the passage of the latter over the alumina catalyst in a flow-type plant with a metal reactor that has application in the field of nanotechnology. | | Preparation | Perhydro acenaphthene is the main raw material of preparation 1,3-dimethyladamantane, is the important intermediate of preparation Derivatives of Adamantane.Derivatives of Adamantane is a kind of excellent antidementia agent, clinical research confirmation its have good efficacy to vascular dementia.
The synthesis of Perhydroacenaphthene:
1) adding industrial acenaphthylene to 95% ethanol, heating, refluxing and dissolving, then cooling, crystallizing, centrifuging to obtain refined acenaphthene, and carrying out distillation recycling of the filtrate;
2) adding the refined acenaphthene and a catalyst Raney Ni into a high-pressure kettle, replacing gas in the kettle with hydrogen, filling hydrogen to make the pressure in the kettle rise to 0.8 MPa, heating up to about 180°C, starting a reaction for 5 h, continuously supplementing hydrogen during the reaction, making the pressure in the kettle rise slowly, and allowing the pressure after the reaction to be 4.0 MPa;
3) cooling after the reaction is finished, filtering the catalyst, and thus obtaining the perhydroacenaphthene.
https://patents.google.com/patent/CN105461499A/en |
| | perhydroacenaphthene Preparation Products And Raw materials |
|