|
|
| | 3-methoxy-alpha-methyl-L-tyrosine Basic information |
| Product Name: | 3-methoxy-alpha-methyl-L-tyrosine | | Synonyms: | 3-methoxy-alpha-methyl-L-tyrosine;[S,(+)]-3-Methoxy-α-methyl-L-tyrosine;3-O-Methyl-L-α-methyldopa;Einecs 229-797-5;Tyrosine, 3-methoxy-alpha-methyl-, L-;Methyldopa IMpurity A;3-Methoxy-α-methyl-L-tyrosine;Methyldopa EP Impurity A | | CAS: | 6739-31-7 | | MF: | C11H15NO4 | | MW: | 225.24 | | EINECS: | 229-797-5 | | Product Categories: | | | Mol File: | 6739-31-7.mol |  |
| | 3-methoxy-alpha-methyl-L-tyrosine Chemical Properties |
| Melting point | 310 °C | | Boiling point | 407.8±45.0 °C(Predicted) | | density | 1.279±0.06 g/cm3(Predicted) | | pka | 2.28±0.26(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C11H15NO4/c1-11(12,10(14)15)6-7-3-4-8(13)9(5-7)16-2/h3-5,13H,6,12H2,1-2H3,(H,14,15)/t11-/m0/s1 | | InChIKey | BQHWFYPBSKGBMV-NSHDSACASA-N | | SMILES | COc1cc(C[C@](C)(N)C(O)=O)ccc1O |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | 3-methoxy-alpha-methyl-L-tyrosine Usage And Synthesis |
| Uses | 3-Methoxy-α-methyl-L-tyrosine is a metabolite of methylenedioxyamphetamine (M303965). | | Uses | 3-Methoxy-α-methyl-L-tyrosine (Methyldopa EP Impurity A) is a metabolite of methylenedioxyamphetamine (M303965). | | Definition | ChEBI: 3-methoxy-alpha-methyl-L-tyrosine is an L-tyrosine derivative in which the tyrosine skeleton is substituted with a methoxy group at C-3 of the phenyl ring and with a methyl group at the alpha carbon. It can also be regarded as a 3-O-methyl,alpha-methyl derivative of L-dopa. It is functionally related to an alpha-methyl-L-dopa. |
| | 3-methoxy-alpha-methyl-L-tyrosine Preparation Products And Raw materials |
|