|
|
| | Dipentaerythritol hexaacrylate Basic information |
| Product Name: | Dipentaerythritol hexaacrylate | | Synonyms: | 2-Propenoic acid, 1,1'-[2-[[3-[(1-oxo-2-propen-1-yl)oxy]-2 ,2-bis[[(1-oxo-2-propen-1-y l)oxy]methyl]propoxy]methyl]-2-[[(1-oxo- 2-propen-1-yl)oxy]methyl]-1,3-p ropanediyl] ester;2-[[3-[(1-oxoallyl)oxy]-2,2-bis[[(1-oxoallyl)oxy]methyl]propoxy]methyl]-2-[[(1-oxoallyl)oxy]methyl]-1,3-propanediyl diacrylate;1,1'-Oxybis[2,2-bis(acryloyloxymethyl)-3-(acryloyloxy)propane];2,2,6,6-Tetrakis(acryloyloxymethyl)-4-oxaheptane-1,7-diol diacrylate;3,3'-Oxybis[2,2-di(acryloyloxymethyl)-1-propanol]1,1'-diacrylate;3-Oxapentane-1,1,1,5,5,5-hexakismethanol hexakisacrylate;Hexakisacrylic acid [oxybis(methylenemethanetetrayl)hexakismethylene] ester;2-Propenoic acid, 2-3-(1-oxo-2-propenyl)oxy-2,2-bis(1-oxo-2-propenyl)oxymethylpropoxymethyl-2-(1-oxo-2-propenyl)oxymethyl-1,3-propanediyl ester | | CAS: | 29570-58-9 | | MF: | C28H34O13 | | MW: | 578.56 | | EINECS: | 249-698-0 | | Product Categories: | Pharmaceutical Intermediates | | Mol File: | 29570-58-9.mol |  |
| | Dipentaerythritol hexaacrylate Chemical Properties |
| Boiling point | 640.7±55.0 °C(Predicted) | | density | 1.184±0.06 g/cm3(Predicted) | | Fp | 266 °C | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | color | Colorless to Light yellow to Light orange clear liquid | | InChI | InChI=1S/C28H34O13/c1-7-21(29)36-15-27(16-37-22(30)8-2,17-38-23(31)9-3)13-35-14-28(18-39-24(32)10-4,19-40-25(33)11-5)20-41-26(34)12-6/h7-12H,1-6,13-20H2 | | InChIKey | MPIAGWXWVAHQBB-UHFFFAOYSA-N | | SMILES | C(OC(=O)C=C)C(COCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C | | EPA Substance Registry System | Dipentaerythritol hexaacrylate (29570-58-9) |
| | Dipentaerythritol hexaacrylate Usage And Synthesis |
| Uses | Dipentaerythritol hexaacrylate is a photochemical, its derivatives can be used as paint additives and coating additives, and multifunctional acrylate, siloxane-containing epoxide as a base component can be used to prepare high-performance transmissive holographic polymer dispersed liquid crystal systems. The performance of holographic gratings is optimised by varying the concentration of functional multifunctional acrylates[1]. | | References | [1] Y.H. CHO Y. K. High performance holographic polymer dispersed liquid crystal systems using multi-functional acrylates and siloxane-containing epoxides as matrix components[J]. Applied Physics A, 2006, 83 3: 365-375. DOI:10.1007/s00339-006-3495-2. |
| | Dipentaerythritol hexaacrylate Preparation Products And Raw materials |
|