|
|
| | 4-(acetylamino)-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide Basic information |
| | 4-(acetylamino)-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide Chemical Properties |
| Melting point | 99-101℃ | | Boiling point | 488.1±45.0 °C(Predicted) | | density | 1.184±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) | | form | powder | | pka | 13.24±0.70(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical small molecule | | InChI | 1S/C10H13NO4S/c1-7-3-5-9(6-4-7)16(14,15)11-10(13)8(2)12/h3-6,8,12H,1-2H3,(H,11,13) | | InChIKey | UGYBMUFRMSFALF-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(NC(=O)C(O)C)c1ccc(cc1)C |
| WGK Germany | 3 | | HS Code | 2924296000 | | Storage Class | 11 - Combustible Solids |
| | 4-(acetylamino)-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide Usage And Synthesis |
| Uses | N-Acetyl Metoclopramide is a related compound of Metoclopramide (M338685). |
| | 4-(acetylamino)-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide Preparation Products And Raw materials |
|