tBuBrettPhos Pd G6 TES manufacturers
|
| | tBuBrettPhos Pd G6 TES Basic information |
| Product Name: | tBuBrettPhos Pd G6 TES | | Synonyms: | tBuBrettPhos Pd G6 TES;(SP-4-2)-Bromo[[3,6-dimethoxy-2′,4′,6′-tris(1-methylethyl)[1,1′-biphenyl]-2-yl-κC1′]bis(1,1-dimethylethyl)phosphine-κP][4-[[2-(trimethylsilyl)ethoxy]carbonyl]phenyl]palladium;Di-tert-butyl(2’,4’,6’-triisopropyl-3,6-dimethoxy-2-biphenylyl)phosphoranyl][4-[[2-(trimethylsilyl)ethoxy]carbonyl]phenyl]palladium(III) Bromide;[Di-tert-butyl(2’,4’,6’-triisopropyl-3,6-dimethoxy-2-biphenylyl)phosphoranyl][4-[[2-(trimethylsilyl)ethoxy]carbonyl]phenyl]palladium(III) Bromide;INNYA-21;(SP-4-2)-[[3,6-Dimethoxy-2′,4′,6′-tri(1-methylethyl)[1,1′-biphenyl]-2-yl-κC1′]bis(1,1-dimethylethyl)phosphine-κP][4-[[2-(trimethylsilyl)ethoxy]carbonyl]phenyl]palladium bromide;t-BuBrettPhos Pd | | CAS: | 2097600-19-4 | | MF: | C43H68BrO4PPdSi | | MW: | 894.4 | | EINECS: | | | Product Categories: | | | Mol File: | 2097600-19-4.mol |  |
| | tBuBrettPhos Pd G6 TES Chemical Properties |
| Melting point | >300°C | | storage temp. | 2-8°C, sealed storage, away from moisture | | form | powder | | Appearance | Light yellow to brown Solid | | InChIKey | ZIQMRJCMTGYLPQ-UHFFFAOYSA-M | | SMILES | [Pd](Br)c3ccc(cc3)C(=O)OCC[Si](C)(C)C.P(C(C)(C)C)(C(C)(C)C)c1c(ccc(c1c2c(cc(cc2C(C)C)C(C)C)C(C)C)OC)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | tBuBrettPhos Pd G6 TES Usage And Synthesis |
| Uses | tBuBrettPhos Pd G6 TES is a G6 Buchwald precatalyst. The G6 precatalysts are air-stable, palladium-based oxidative addition complexes (OACs) that offer an alternative to the previously developed classes of palladacycle precatalysts. Unlike previous generations, the bulkiest biarylphosphine ligand precatalysts are readily prepared. These precatalysts have been shown to be effective for many reactions, including C-N, C-O, and C-F cross couplings.
Learn more about G6 Buchwald precatalysts | | reaction suitability | reagent type: catalyst
reaction type: Cross Couplings |
| | tBuBrettPhos Pd G6 TES Preparation Products And Raw materials |
|