|
|
| | 1,3-bis[3-(dimethylamino)propyl]urea Basic information |
| Product Name: | 1,3-bis[3-(dimethylamino)propyl]urea | | Synonyms: | bis(dimethylaminopropyl)urea;1,3-bis[3-(dimethylamino)propyl]urea;Urea, N,N-bis3-(dimethylamino)propyl-;1,3-Bis[3-(dimethylamino)propyl]harnstoff;N,N'-Bis[3-(dimethylamino)propyl]urea;Einecs 257-861-2;Niax* catalyst EF-700;1,3-bis[3-(dimethylamino)propyl]urea ISO 9001：2015 REACH | | CAS: | 52338-87-1 | | MF: | C11H26N4O | | MW: | 230.35 | | EINECS: | 257-861-2 | | Product Categories: | Building Blocks/Intermediates | | Mol File: | 52338-87-1.mol | ![1,3-bis[3-(dimethylamino)propyl]urea Structure](CAS/GIF/52338-87-1.gif) |
| | 1,3-bis[3-(dimethylamino)propyl]urea Chemical Properties |
| Boiling point | 377.8±27.0 °C(Predicted) | | density | 0.962±0.06 g/cm3(Predicted) | | vapor pressure | 4.799hPa at 21.1℃ | | storage temp. | 2-8°C | | pka | 14.12±0.46(Predicted) | | Appearance | Colorless to light yellow Viscous Liquid | | Water Solubility | 10g/L at 20℃ | | InChI | InChI=1S/C11H26N4O/c1-14(2)9-5-7-12-11(16)13-8-6-10-15(3)4/h5-10H2,1-4H3,(H2,12,13,16) | | InChIKey | FCQPNTOQFPJCMF-UHFFFAOYSA-N | | SMILES | N(CCCN(C)C)C(NCCCN(C)C)=O | | LogP | -0.085 at 20℃ | | EPA Substance Registry System | N,N'-Bis[3-(dimethylamino)propyl]urea (52338-87-1) |
| | 1,3-bis[3-(dimethylamino)propyl]urea Usage And Synthesis |
| Synthesis | A mixture of N,N-dimethyl-1,3-diaminopropane (51.09 g, 0.5 mol) and urea (15.01 g, 0.25 mol) was added to a round bottom flask. The reaction system was heated to 125 °C and kept under reflux with stirring for 8 hours. During the reaction, high purity nitrogen was continuously passed to bring out the generated ammonia and trap it by 30 wt% sulfuric acid solution. Upon completion of the reaction, a clarified colorless liquid product of 1,3-bis[3-(dimethylamino)propyl]urea (58.52 g, yield: 88.65%) was obtained. | | References | [1] Journal of the Electrochemical Society, 2014, vol. 161, # 12, p. D651 - D656
[2] Journal of Organometallic Chemistry, 2005, vol. 690, # 11, p. 2757 - 2760 |
| | 1,3-bis[3-(dimethylamino)propyl]urea Preparation Products And Raw materials |
|