|
|
| | 21-hydroxy-20-methylpregn-4-en-3-one Basic information |
| Product Name: | 21-hydroxy-20-methylpregn-4-en-3-one | | Synonyms: | 2O-Hydroxymethyl-4-pregnen-3-on;Progesterone Impurity 2;21-hydroxy-20-methylpregn-4-en-3-one;20-(Hydroxymethyl)pregna-4-ene-3-one;20-Hydroxymethylpregn-4-en-3-one;Pregn-4-en-3-one, 21-hydroxy-20-methyl-;21-hydroxy-20-methylpregn-4-en-3-one[BA];(8S,9S,10R,13S,14S,17R)-17-(1-hydroxypropan-2-yl)-10,13-dimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one | | CAS: | 60966-36-1 | | MF: | C22H34O2 | | MW: | 330.5 | | EINECS: | 262-543-1 | | Product Categories: | 60966-36-1 | | Mol File: | 60966-36-1.mol |  |
| | 21-hydroxy-20-methylpregn-4-en-3-one Chemical Properties |
| Boiling point | 464.1±14.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | pka | 14.97±0.10(Predicted) | | InChIKey | ZNWOYQVXPIEQRC-ZRFCQXGJSA-N | | SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)[C@@H](C(C)CO)CC3)CC2 |
| | 21-hydroxy-20-methylpregn-4-en-3-one Usage And Synthesis |
| Chemical Properties | 21-Hydroxy-20-methylpregn-4-en-3-one is a white to off-white solid powder at room temperature and pressure, and can be oxidized. | | Uses | 21-Hydroxy-20-methylpregn-4-en-3one is an impurity of the steroid hormone, progesterone (P755900), produced by the corpus luteum and induces maturation and secretory activity of the uterine endothelium; suppresses ovulation. | | Toxics Screening Level | The initial threshold screening level (ITSL) for bisnoralcohol is 17 μg/m3 based on an annual averaging time. |
| | 21-hydroxy-20-methylpregn-4-en-3-one Preparation Products And Raw materials |
|