- L-Glu-OtBu
-
- $0.00 / 1kg
-
2026-03-31
- CAS:45120-30-7
- Min. Order: 1kg
- Purity: 98+
- Supply Ability: 1T
|
| | L-Glutamic acid α-tert·butyl ester Basic information |
| | L-Glutamic acid α-tert·butyl ester Chemical Properties |
| Melting point | 140 °C | | Boiling point | 326.8±32.0 °C(Predicted) | | density | 1.133±0.06 g/cm3(Predicted) | | refractive index | 14 ° (C=1, H2O) | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Sparingly, Sonicated) | | form | Powder | | pka | 4.22±0.10(Predicted) | | color | White | | InChI | InChI=1S/C9H17NO4/c1-9(2,3)14-8(13)6(10)4-5-7(11)12/h6H,4-5,10H2,1-3H3,(H,11,12)/t6-/m0/s1 | | InChIKey | QVAQMUAKTNUNLN-LURJTMIESA-N | | SMILES | C(OC(C)(C)C)(=O)[C@H](CCC(O)=O)N | | CAS DataBase Reference | 45120-30-7 |
| | L-Glutamic acid α-tert·butyl ester Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | L-Glutamic Acid α-tert-Butyl Ester is an ester of L-Glutamic Acid used in the synthesis of enantiopure isotopomers of amino acids. |
| | L-Glutamic acid α-tert·butyl ester Preparation Products And Raw materials |
|