|
|
| | 3-Chloro-6-trifluoromethyl-pyridazine Basic information | | Uses |
| | 3-Chloro-6-trifluoromethyl-pyridazine Chemical Properties |
| Melting point | 55-59°C | | Boiling point | 233.3±35.0 °C(Predicted) | | density | 1.504 | | Fp | 95℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -1.53±0.10(Predicted) | | form | solid | | color | Light yellow | | InChI | InChI=1S/C5H2ClF3N2/c6-4-2-1-3(10-11-4)5(7,8)9/h1-2H | | InChIKey | AZNKQIFEMQHORS-UHFFFAOYSA-N | | SMILES | C1(Cl)=NN=C(C(F)(F)F)C=C1 | | CAS DataBase Reference | 258506-68-2 |
| Hazard Codes | T | | Risk Statements | 25-36/38 | | Safety Statements | 26-45-24/25 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 29339900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 |
| | 3-Chloro-6-trifluoromethyl-pyridazine Usage And Synthesis |
| Uses | 3-Chloro-6-(trifluoromethyl)pyridazine is a general reagent for use in the repositioning of antitubercular oxazoles for certain neglected tropical diseases. | | Chemical Properties | White crystalline powder | | Uses | 3-Chloro-6-(trifluoromethyl)pyridazine is a general reagent for use in the repositioning of antitubercular oxazoles for certain neglected tropical diseases. |
| | 3-Chloro-6-trifluoromethyl-pyridazine Preparation Products And Raw materials |
|