|
|
| | 056-(FERROCENYL)HEXANETHIOL Basic information |
| Product Name: | 056-(FERROCENYL)HEXANETHIOL | | Synonyms: | 6-(Ferrocenyl)hexanethiol,6-(Mercaptohexyl)ferrocene;FERROCENYL)HEXANETHIOL;056-(FERROCENYL)HEXANETHIOL;6-(Ferrocenyl)hexanethiol;6-(Mercaptohexyl)ferrocene;FHT;056-(FERROCENYL)HEXANETHIOL ISO 9001：2015 REACH;Ferrocene,(6-mercaptohexyl)- | | CAS: | 134029-92-8 | | MF: | C11H17S.C5H5.Fe | | MW: | 302.261 | | EINECS: | | | Product Categories: | Elisa Kit-plant ELISA Kit | | Mol File: | 134029-92-8.mol |  |
| | 056-(FERROCENYL)HEXANETHIOL Chemical Properties |
| Boiling point | 321-353 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | Appearance | Yellow to brown Solid-Liquid Mixture | | InChI | 1S/C11H17S.C5H5.Fe/c12-10-6-2-1-3-7-11-8-4-5-9-11;1-2-4-5-3-1;/h4-5,8-9,12H,1-3,6-7,10H2;1-5H; | | InChIKey | YENJERDZPAXYRX-UHFFFAOYSA-N | | SMILES | [Fe].[CH]1[CH][CH][CH][CH]1.SCCCCCC[C]2[CH][CH][CH][CH]2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | RIDADR | UN 3334 | | WGK Germany | 3 | | HS Code | 29309090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 056-(FERROCENYL)HEXANETHIOL Usage And Synthesis |
| Chemical Properties | Dark red liquid | | Uses | FHT can be used as a SAM on gold substrates to act as an electron transport medium which can be potentially used in bio-electrochemical devices. FHT may also be used to functionalize graphene coated gold surfaces by forming gold-thiol linkages which can be used as electron transfer mediators. | | General Description | 6-(Ferrocenyl)hexanethiol (FHT) is a ferrocenyl alkanethiol that forms a self-assembled monolayer (SAM) where ferrocenyl linkages can facilitate the electron exchange between the coating and the substrate. |
| | 056-(FERROCENYL)HEXANETHIOL Preparation Products And Raw materials |
|