|
|
| | 4-METHOXYBENZYL-2,2,2-TRICHLOROACETIMID& Basic information |
| Product Name: | 4-METHOXYBENZYL-2,2,2-TRICHLOROACETIMID& | | Synonyms: | 4-METHOXYBENZYL-2,2,2-TRICHLOROACETIMID&;2,2,2-Trichloroacetimidic Acid 4-Methoxybenzyl Ester;4-Methoxybenzyl 2,2,2-Trichloroacetimidate;4-Methoxybenzyl trichloroacetimidate;4-methoxybenzyl 2,2,2-trichloroethanimidoate;4-Methoxybenzyl trichloroacetamidate;4-Methoxybenzyl2,2,2-Trichloroacetimidate>;2,2,2-trichlorohydrin-4-methoxybenzyl ester per acetic acid | | CAS: | 89238-99-3 | | MF: | C10H10Cl3NO2 | | MW: | 282.55 | | EINECS: | | | Product Categories: | Others;Protecting and Derivatizing Reagents;Protection and Derivatization;Protection & Derivatization Reagents (for Synthesis);Synthetic Organic Chemistry | | Mol File: | 89238-99-3.mol |  |
| | 4-METHOXYBENZYL-2,2,2-TRICHLOROACETIMID& Chemical Properties |
| Boiling point | 137 °C / 0.7mmHg | | density | 1.361 g/mL at 25 °C | | refractive index | n20/D 1.5488 | | Fp | 110 °C | | storage temp. | 2-8°C | | pka | 1.96±0.70(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Major Application | peptide synthesis | | InChI | InChI=1S/C10H10Cl3NO2/c1-15-8-4-2-7(3-5-8)6-16-9(14)10(11,12)13/h2-5,14H,6H2,1H3 | | InChIKey | TYHGKLBJBHACOI-UHFFFAOYSA-N | | SMILES | C(=N)(OCC1=CC=C(OC)C=C1)C(Cl)(Cl)Cl |
| | 4-METHOXYBENZYL-2,2,2-TRICHLOROACETIMID& Usage And Synthesis |
| Uses | 4-Methoxybenzyl-2,2,2-trichloroacetimidate can be used as a reagent for the protection of alcohols as the p-methoxybenzyl ether. 1o, 2o, and 3o alcohols can be easily protected using this reagent with equal efficiency in the presence of a variety of different protective groups. This reagent is commonly used under acidic conditions therefore it offers an alternative method to the Williamson ether synthesis, which is typically used basic conditions to protect base-sensitive alcohols. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | 4-METHOXYBENZYL-2,2,2-TRICHLOROACETIMID& Preparation Products And Raw materials |
|