| Company Name: |
Biokitchen |
| Tel: |
021-021-021-31663258 13795219287 |
| Email: |
donghuanwen@126.com |
|
| | 2-Propen-1-one, 1-(2,4-dihydroxyphenyl)-3-(2-methoxyphenyl)- Basic information |
| | 2-Propen-1-one, 1-(2,4-dihydroxyphenyl)-3-(2-methoxyphenyl)- Chemical Properties |
| Melting point | 175-178° | | Boiling point | 484.3±37.0 °C(Predicted) | | density | 1.282±0.06 g/cm3(Predicted) | | form | solid | | pka | 7.36±0.35(Predicted) | | InChI | 1S/C16H14O4/c1-20-16-5-3-2-4-11(16)6-9-14(18)13-8-7-12(17)10-15(13)19/h2-10,17,19H,1H3/b9-6+ | | InChIKey | ODLVGCCGMXGMGZ-RMKNXTFCSA-N | | SMILES | COc1ccccc1\C=C\C(=O)c2ccc(O)cc2O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Propen-1-one, 1-(2,4-dihydroxyphenyl)-3-(2-methoxyphenyl)- Usage And Synthesis |
| | 2-Propen-1-one, 1-(2,4-dihydroxyphenyl)-3-(2-methoxyphenyl)- Preparation Products And Raw materials |
|