Benzoic acid, 4-[(2R,4R)-4-ethoxy-2-piperidinyl]-, methyl ester, rel- manufacturers
|
| | Benzoic acid, 4-[(2R,4R)-4-ethoxy-2-piperidinyl]-, methyl ester, rel- Basic information |
| | Benzoic acid, 4-[(2R,4R)-4-ethoxy-2-piperidinyl]-, methyl ester, rel- Chemical Properties |
| Boiling point | 377.2±42.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | pka | 8.72±0.10(Predicted) | | InChI | InChI=1/C15H21NO3/c1-3-19-13-8-9-16-14(10-13)11-4-6-12(7-5-11)15(17)18-2/h4-7,13-14,16H,3,8-10H2,1-2H3/t13-,14-/s3 | | InChIKey | DZNZBIFPILZUCT-HCTHJJLONA-N | | SMILES | C(OC)(=O)C1=CC=C([C@H]2C[C@H](OCC)CCN2)C=C1 |&1:8,10,r| |
| | Benzoic acid, 4-[(2R,4R)-4-ethoxy-2-piperidinyl]-, methyl ester, rel- Usage And Synthesis |
| | Benzoic acid, 4-[(2R,4R)-4-ethoxy-2-piperidinyl]-, methyl ester, rel- Preparation Products And Raw materials |
|