Levamlodipine Besylate manufacturers
- Levamlodipine Besylate
-
- $50.00 / 25kg
-
2024-04-22
- CAS:150566-71-5
- Min. Order: 1kg
- Purity: 99.9%
- Supply Ability: 200000kg
|
| | Levamlodipine Besylate Basic information |
| Product Name: | Levamlodipine Besylate | | Synonyms: | 3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, (4S)-, monobenzenesulfonate;LEVAMLODIPINE BESYLATE，S-Amlodipine;LEVAMLODIPINE BESYLATE;Levamlodipine besylate( (S)-Amlodipine besylate);Ca2+ channels,Levoamlodipine besylate,Levamlodipine besylate,(S)-Amlodipine besylate,Ca channels,Calcium Channel,inhibit,Inhibitor;Amlodipine Impurity 16 Benzenesulfonic Acid;3-Ethyl 5-methyl (S)-2-((2-aminoethoxy)methyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate benzenesulfonate;S-Amlodipine Benzenesulfonate | | CAS: | 150566-71-5 | | MF: | C26H31ClN2O8S | | MW: | 567.05094 | | EINECS: | | | Product Categories: | | | Mol File: | 150566-71-5.mol |  |
| | Levamlodipine Besylate Chemical Properties |
| storage temp. | -20°C, protect from light | | solubility | DMSO : ≥ 150 mg/mL (264.53 mM) | | form | Solid | | color | White to light yellow | | InChIKey | ZPBWCRDSRKPIDG-VOPAOICTNA-N | | SMILES | O=S(=O)(O)C1=CC=CC=C1.O=C(OCC)C1[C@@H](C2=C(Cl)C=CC=C2)C(C(=O)OC)=C(C)NC=1COCCN |&1:16,r| |
| | Levamlodipine Besylate Usage And Synthesis |
| Uses | Levamlodipine Besylate is the (S)-Enantiomer salt of Amlodipine (A633495). A dihydropyridine calcium channel blocker; activity resides mainly in the (-)-isomer. | | in vivo | Levamlodipine besylate (0.1, 0.5 mg/kg, once daily; 8 weeks; p.o.) can restore hippocampal Ca2+/CaM dependent protein kinase II (CaMKII) and alleviate hippocampal dependent spatial cognitive impairment in vascular dementia mice[1].
Levamlodipine besylate (1 mg/kg, once daily; 16 weeks; p.o.) can lower blood pressure and protect organs in spontaneously hypertensive rats[3]. | Animal Model: | Spontaneously hypertensive rats (SHR)[3]. | | Dosage: | 1 mg/kg | | Administration: | Oral gavage (p.o.); once daily; 16 weeks | | Result: | Reduced systolic blood pressure (SBP) and diastolic blood pressure (DBP), reduced heart and aortic hypertrophy, increased kidney weight to prevent kidney atrophy. |
| Animal Model: | VaD mice model of right unilateral common carotid arteries occlusion (rUCCAO)[1]. | | Dosage: | 0.1, 0.5 mg/kg | | Administration: | Oral gavage (p.o.); once daily; 8 weeks | | Result: | Recovered phosphorylated CaMKII (Thr286) levels in the hippocampus and improved cognitive impairment in mice. |
|
| | Levamlodipine Besylate Preparation Products And Raw materials |
|