|
|
| | 2-Chloro-3-Nitro-5-Bromo-6-Picoline Basic information |
| Product Name: | 2-Chloro-3-Nitro-5-Bromo-6-Picoline | | Synonyms: | 2-Chloro-3-Nitro-5-Bromo-6-Picoline;3-Bromo-6-chloro-2-methyl-5-nitropyridine ,97%;Pyridine,3-broMo-6-chloro-2-Methyl-5-nitro-;2-Chloro-3-nitro-5-bromo-6-methylpyridine;3-Bromo-6-chL;2-Chloro-3-Nitro-5-Bromo-6-Picoline ISO 9001：2015 REACH;2-CHLORO-3-NITRO-5-BROMO-6-PICOLINE (0.25 KGS);5-broMo-2-chloro-6-Methyl-3-nitropyridine | | CAS: | 186413-75-2 | | MF: | C6H4BrClN2O2 | | MW: | 251.47 | | EINECS: | | | Product Categories: | Pyridine | | Mol File: | 186413-75-2.mol |  |
| | 2-Chloro-3-Nitro-5-Bromo-6-Picoline Chemical Properties |
| Boiling point | 306.3±37.0 °C(Predicted) | | density | 1.810±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -4.02±0.10(Predicted) | | Appearance | Light brown to yellow Solid | | InChI | InChI=1S/C6H4BrClN2O2/c1-3-4(7)2-5(10(11)12)6(8)9-3/h2H,1H3 | | InChIKey | PVECCSKVOZZRPC-UHFFFAOYSA-N | | SMILES | C1(C)=NC(Cl)=C([N+]([O-])=O)C=C1Br |
| Risk Statements | 20/22 | | Safety Statements | 36/37 | | HS Code | 29339900 |
| | 2-Chloro-3-Nitro-5-Bromo-6-Picoline Usage And Synthesis |
| Chemical Properties | Yellow solid |
| | 2-Chloro-3-Nitro-5-Bromo-6-Picoline Preparation Products And Raw materials |
|