| Company Name: |
SuZhou ShiYa Biopharmaceuticals, Inc.
|
| Tel: |
0512-0512-52358471 17715136450 |
| Email: |
sales@shiyabiopharm.com |
| Products Intro: |
Product Name:8-Bromo-5-methyl-quinoline CAS:823803-51-6 Purity:>97% Package:1g;5g Remarks:B1-4288
|
| Company Name: |
Zhengzhou Huiju Chemical Co., Ltd.
|
| Tel: |
0371-55900031 18137872243 |
| Email: |
3927209986@qq.com |
| Products Intro: |
Product Name:8-Bromo-5-methylquinoline CAS:823803-51-6 Purity:98% Package:100mg ;500mg ;1g ;5g ;10g ;25g ;50g ;100g ;250g ;500g ;1kg ;5kg
|
|
| | Quinoline, 8-bromo-5-methyl- (9CI) Basic information |
| | Quinoline, 8-bromo-5-methyl- (9CI) Chemical Properties |
| Boiling point | 315.7±22.0 °C(Predicted) | | density | 1.488±0.06 g/cm3(Predicted) | | form | solid | | pka | 2.56±0.29(Predicted) | | InChI | 1S/C10H8BrN/c1-7-4-5-9(11)10-8(7)3-2-6-12-10/h2-6H,1H3 | | InChIKey | PKRAUXDALIFLEC-UHFFFAOYSA-N | | SMILES | CC1=C(C=CC=N2)C2=C(Br)C=C1 |
| Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Quinoline, 8-bromo-5-methyl- (9CI) Usage And Synthesis |
| | Quinoline, 8-bromo-5-methyl- (9CI) Preparation Products And Raw materials |
|