|
|
| | 1,1'-Binaphthyl-2,2'-diyl hydrogenphosphate Basic information |
| Product Name: | 1,1'-Binaphthyl-2,2'-diyl hydrogenphosphate | | Synonyms: | (+/-)-1,1'-BINAPHTHYL-2,2'-DIYL HYDROGENPHOSPHATE;1,1'-BINAPHTHYL-2,2'-DIYL HYDROGENPHOSPHATE;(+/-)-2,2'-DIHYDROXY-1,1'-BINAPHTHYL HYDROGENPHOSPHATE;2-HYDROXY-2LAMBDA5-DINAPHTHO[2,1-D:1,2-F][1,3,2]DIOXAPHOSPHEPIN-2-ONE;4-Hydroxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin 4-oxide;(R)-(-)-2,2'-DIHYDROXY-1,1'-BINAPHTHYL HYDROGENPHOSPHATE;(R)-4-HYDROXY DINAPHTHO[2,1-D:1',2'-F][1,3,2]-DIOXAPHOSPHEPIN-4-OXID;(R)-4-HYDROXYDINAPHTHO[2,1-D:1',2'-F][1,3,2]DIOXAPHOSPHEPIN-4-OXIDE | | CAS: | 35193-63-6 | | MF: | C20H13O4P | | MW: | 348.29 | | EINECS: | 252-425-8 | | Product Categories: | Achiral Phosphine;Aryl Phosphine;Phosphorus Catalysts;Catalysis and Inorganic Chemistry;Phosphorus Compounds;chiral | | Mol File: | 35193-63-6.mol |  |
| | 1,1'-Binaphthyl-2,2'-diyl hydrogenphosphate Chemical Properties |
| Melting point | ≥300 °C | | Boiling point | 619.5±38.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 1.14±0.20(Predicted) | | form | Solid | | color | White to Yellow to Orange | | Optical Rotation | Consistent with structure | | Water Solubility | Extremely low soluble in water. | | InChI | InChI=1S/C20H13O4P/c21-25(22)23-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)24-25/h1-12H,(H,21,22) | | InChIKey | JEHUZVBIUCAMRZ-UHFFFAOYSA-N | | SMILES | O1C2=CC=C3C(=C2C2=C4C(C=CC=C4)=CC=C2OP1(=O)O)C=CC=C3 | | CAS DataBase Reference | 35193-63-6(CAS DataBase Reference) |
| | 1,1'-Binaphthyl-2,2'-diyl hydrogenphosphate Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | 1,1'-Binaphthyl-2,2'-diyl hydrogen phosphate, is used as a chiral chemical compound, a chiral ligand used in hydrocarboxylation reactions. Complexes with rhodium and mediates the asymmetric dipolar cycloaddition of diazo compounds. A number of racemic amines which have proven difficult to separate have been resolved with this chiral acid. Palladium derivatives have been used in asymmetric hydrocarboxylations, and rhodium derivatives have been used in dipolar cycloadditions. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling |
| | 1,1'-Binaphthyl-2,2'-diyl hydrogenphosphate Preparation Products And Raw materials |
|