|
|
| | 2-Butyrylaminopropinicacid Basic information |
| Product Name: | 2-Butyrylaminopropinicacid | | Synonyms: | 2-Butyrylaminopropinicacid;Alanin, N-(1-oxobutyl)-;2-Butyramidopropanoic acid;DL-Alanine, N-(1-oxobutyl)-;N-(1-Oxobutyl)alanine;N-(1-Oxobutyl)-DL-alanine;Alanine,N-(1-oxobutyl)-;(S)-2-Butyramidopropanoic acid | | CAS: | 59875-04-6 | | MF: | C7H13NO3 | | MW: | 159.18 | | EINECS: | 611-909-2 | | Product Categories: | | | Mol File: | 59875-04-6.mol |  |
| | 2-Butyrylaminopropinicacid Chemical Properties |
| Melting point | >186°C (dec.) | | Boiling point | 371.8±25.0 °C(Predicted) | | density | 1.097 | | vapor pressure | 0.001-0.478Pa at 20-86.55℃ | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | DMSO, Methanol | | pka | 3.69±0.10(Predicted) | | form | Solid | | color | White | | InChI | InChI=1S/C7H13NO3/c1-3-4-6(9)8-5(2)7(10)11/h5H,3-4H2,1-2H3,(H,8,9)(H,10,11)/t5-/m0/s1 | | InChIKey | DTIMTCJMOWXMGT-YFKPBYRVSA-N | | SMILES | C(O)(=O)[C@H](C)NC(=O)CCC | | Surface tension | 71.9mN/m at 1g/L and 20℃ |
| | 2-Butyrylaminopropinicacid Usage And Synthesis |
| Uses | N-(1-Oxobutyl)-DL-alanine is a reactant used to prepare Vardenafil (V098001, 2HCl salt) which is a selective phosphodiesterase type 5 (PDE5) inhibitor. |
| | 2-Butyrylaminopropinicacid Preparation Products And Raw materials |
|