| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | (E)-2-(4-Boc-piperazin-1-yl)-4-cyclohexyl-3-butenoic acid Basic information |
| Product Name: | (E)-2-(4-Boc-piperazin-1-yl)-4-cyclohexyl-3-butenoic acid | | Synonyms: | (E)-2-[4-(TERT-BUTOXYCARBONYL)PIPERAZIN-1-YL]-4-CYCLOHEXL-3-BUTENOIC ACID;1-Piperazineacetic acid, α-(2-cyclohexylethenyl)-4-[(1,1-dimethylethoxy)carbonyl]-;(E)-2-(4-Boc-piperazin-1-yl)-4-cyclohexyl-3-butenoic acid 97%;(E)-2-(4-Boc-piperazin-1-yl)-4-cyclohexyl-3-butenoic acid;(E)-2-(4-Boc-piperazin-1-yl)-4-cyclohexyl-3-butenoic acid | | CAS: | 890090-63-8 | | MF: | C19H32N2O4 | | MW: | 352.47 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | (E)-2-(4-Boc-piperazin-1-yl)-4-cyclohexyl-3-butenoic acid Chemical Properties |
| Melting point | 166-170 °C(lit.) | | Boiling point | 482.3±45.0 °C(Predicted) | | density | 1.162±0.06 g/cm3(Predicted) | | form | solid | | pka | 2.13±0.10(Predicted) | | InChI | 1S/C19H32N2O4/c1-19(2,3)25-18(24)21-13-11-20(12-14-21)16(17(22)23)10-9-15-7-5-4-6-8-15/h9-10,15-16H,4-8,11-14H2,1-3H3,(H,22,23)/b10-9+ | | InChIKey | ALAMTNODLVYHHG-MDZDMXLPSA-N | | SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(\C=C\C2CCCCC2)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (E)-2-(4-Boc-piperazin-1-yl)-4-cyclohexyl-3-butenoic acid Usage And Synthesis |
| | (E)-2-(4-Boc-piperazin-1-yl)-4-cyclohexyl-3-butenoic acid Preparation Products And Raw materials |
|