|
|
| | 4-Bromo-3-methylphenylboronic acid Basic information |
| Product Name: | 4-Bromo-3-methylphenylboronic acid | | Synonyms: | Boronic acid, B-(4-bromo-3-methylphenyl)-;4-Bromo-3-methylphenylboronic acid(contains varying amounts of Anhydride);4-Bromo-3-methylphenylboronic acid | | CAS: | 221006-67-3 | | MF: | C7H8BBrO2 | | MW: | 214.85 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 4-Bromo-3-methylphenylboronic acid Chemical Properties |
| Melting point | >250 °C(Solv: acetonitrile (75-05-8)) | | Boiling point | 336.1±52.0 °C(Predicted) | | density | 1.57±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 8.36±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H8BBrO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4,10-11H,1H3 | | InChIKey | WATLRNVCMDWRNM-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(Br)C(C)=C1)(O)O |
| | 4-Bromo-3-methylphenylboronic acid Usage And Synthesis |
| | 4-Bromo-3-methylphenylboronic acid Preparation Products And Raw materials |
|