|
|
| | 6-AZIDO-6-DEOXY-D-GALACTOSE Basic information |
| | 6-AZIDO-6-DEOXY-D-GALACTOSE Chemical Properties |
| Melting point | 144-145 °C | | storage temp. | 2-8°C | | form | powder | | Optical Rotation | [α]/D 57.0±4.0°, c = 1 in H2O | | BRN | 7569066 | | InChI | 1S/C6H11N3O5/c7-9-8-1-2-3(10)4(11)5(12)6(13)14-2/h2-6,10-13H,1H2/t2-,3+,4+,5-,6?/m1/s1 | | InChIKey | CMLRUUHRGSJVMD-SVZMEOIVSA-N | | SMILES | OC1O[C@H](CN=[N+]=[N-])[C@H](O)[C@H](O)[C@H]1O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 2940000080 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | 6-AZIDO-6-DEOXY-D-GALACTOSE Usage And Synthesis |
| Uses | 6-Azido-6-deoxy-D-galactose is a new selective metabolic chemical reporter (MCR) for labeling O-??GlcNAc-??modified proteins in cells. | | reaction suitability | reaction type: click chemistry |
| | 6-AZIDO-6-DEOXY-D-GALACTOSE Preparation Products And Raw materials |
|