|
|
| | 2-Thiophenecarboxylic acid, 4-bromo-3-fluoro-, methyl ester Basic information |
| | 2-Thiophenecarboxylic acid, 4-bromo-3-fluoro-, methyl ester Chemical Properties |
| Boiling point | 267.1±40.0 °C(Predicted) | | density | 1.742±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H4BrFO2S/c1-10-6(9)5-4(8)3(7)2-11-5/h2H,1H3 | | InChIKey | WOIOEHSFRAGWFF-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)SC=C(Br)C=1F |
| | 2-Thiophenecarboxylic acid, 4-bromo-3-fluoro-, methyl ester Usage And Synthesis |
| | 2-Thiophenecarboxylic acid, 4-bromo-3-fluoro-, methyl ester Preparation Products And Raw materials |
|