|
|
| | 1-Thio-β-D-glucose tetraacetate Basic information |
| Product Name: | 1-Thio-β-D-glucose tetraacetate | | Synonyms: | 1-THIO-BETA-D-GLUCOSE TETRAACETATE;2,3,4,6-TETRA-O-ACETYL-1-THIO-BETA-D-GLUCOPYRANOSE;2,3,4,6-TETRA-O-ACETYL-1-THIO-BETA-D-THIOGLUCOPYRANOSE;1-thio-beta-D-glucose 2,3,4,6-tetraacetate;1-THIO-B-D-GLUCOSE TETRAACETATE;.beta.-D-Glucopyranose, 1-thio-, 2,3,4,6-tetraacetate;2,3,4,6-Tetra-O-acetyl-b-D-thioglucopyranose;1-THIO-SS-D-GLUCOSE TETRAACETATE | | CAS: | 19879-84-6 | | MF: | C14H20O9S | | MW: | 364.37 | | EINECS: | 243-392-0 | | Product Categories: | substrate;Carbohydrates;Glycon Biochem | | Mol File: | 19879-84-6.mol |  |
| | 1-Thio-β-D-glucose tetraacetate Chemical Properties |
| Melting point | 115-117 °C(lit.) | | Boiling point | 425.5±45.0 °C(Predicted) | | density | 1.31±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform, Dichloromethane, Ethyl Acetate | | pka | 8.42±0.70(Predicted) | | form | Solid | | color | Colorless | | Optical Rotation | [α]20/D +5.8°, c = 2.2 in chloroform | | Water Solubility | Soluble in water and chloroform (50 mg/ml). | | BRN | 1440689 | | InChI | InChI=1/C14H20O9S/c1-6(15)19-5-10-11(20-7(2)16)12(21-8(3)17)13(14(24)23-10)22-9(4)18/h10-14,24H,5H2,1-4H3/t10-,11-,12+,13-,14+/s3 | | InChIKey | SFOZKJGZNOBSHF-RGDJUOJXSA-N | | SMILES | [C@@H]1(OC(=O)C)[C@@H](OC(=O)C)[C@@H](O[C@H](COC(=O)C)[C@H]1OC(=O)C)S |&1:0,5,10,12,18,r| | | CAS DataBase Reference | 19879-84-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | 1-Thio-β-D-glucose tetraacetate Usage And Synthesis |
| Description |
1-thio-β-D-Glucose tetraacetate is a building block. It has been used in the synthesis of aromatic glucosinolates with anti-inflammatory activity, as well as glucosylated poly(pentafluorostyrene) derivatives for coating magnetic iron oxide nanoparticles.
| | Chemical Properties | White crystalline powder | | Uses | A synthetic intermediate. | | Uses | 1-Thio-beta-D-glucose tetraacetate is used as an inhibitor of the Maillard reaction between glucose and glycine. | | References | [1] QUAN V. VO . Synthesis and anti-inflammatory activity of aromatic glucosinolates[J]. Bioorganic & Medicinal Chemistry, 2013, 21 19: Pages 5945-5954. DOI: 10.1016/j.bmc.2013.07.049
[2] KRZYSZTOF BABIUCH. Functionalized, Biocompatible Coating for Superparamagnetic Nanoparticles by Controlled Polymerization of a Thioglycosidic Monomer[J]. Biomacromolecules, 2011, 12 3: 681-691. DOI: 10.1021/bm101325w |
| | 1-Thio-β-D-glucose tetraacetate Preparation Products And Raw materials |
|