|
|
| | Ropivacaine impurity G Basic information |
| Product Name: | Ropivacaine impurity G | | Synonyms: | Ropivacaine impurity G;(+)-(2R)-N-(2,6-Dimethylphenyl)-1-propylpiperidine-2-carboxamide;(R)-Ropivacaine;Ropivacaine impurity 10/Ropivacaine EP Impurity G/(R)-Ropivacaine/(R)-N-(2,6-Dimethylphenyl)-1-propyl-2-piperidinecarboxamide;2-Piperidinecarboxamide, N-(2,6-dimethylphenyl)-1-propyl-, (2R)-;3-Aminomethylpyrene,hydrochloride;1-(1H-1,3-BENZODIAZOL-2-YL)-1H-PYRAZOL-10-AMINE;Ropivacaine EP Impurity G ((R)-Ropivacaine) | | CAS: | 98717-16-9 | | MF: | C17H26N2O | | MW: | 274.4 | | EINECS: | | | Product Categories: | | | Mol File: | 98717-16-9.mol |  |
| | Ropivacaine impurity G Chemical Properties |
| Boiling point | 410.2±45.0 °C(Predicted) | | density | 1.044±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 14.85±0.70(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H26N2O/c1-4-11-19-12-6-5-10-15(19)17(20)18-16-13(2)8-7-9-14(16)3/h7-9,15H,4-6,10-12H2,1-3H3,(H,18,20)/t15-/m1/s1 | | InChIKey | ZKMNUMMKYBVTFN-OAHLLOKOSA-N | | SMILES | N1([C@H](CCCC1)C(=O)Nc2c(cccc2C)C)CCC | | CAS DataBase Reference | 98717-16-9 |
| | Ropivacaine impurity G Usage And Synthesis |
| Uses | Ropivacaine impurity G EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. | | Hazard | Human systemic effects. |
| | Ropivacaine impurity G Preparation Products And Raw materials |
|