- 9,10-Di(1-naphthyl)anthracene
-
- $188.00 / 1KG
-
2025-09-25
- CAS:26979-27-1
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 9,10-Di(1-naphthyl)anthracene Basic information |
| Product Name: | 9,10-Di(1-naphthyl)anthracene | | Synonyms: | 9,10-DI-(1-NAPHTHYL)ANTHRACENE;9,10-DI-NAPHTHALEN-1-YL-ANTHRACENE;9,10-Di-(1-naphthyl);9,10-Di(1-naphthayl)anthracene (purified by sublimation);9,10-Di(-α-naphthyl)anthracen;9,10-Di(1-naphthyl)anthracene>;Anthracene, 9,10-di-1-naphthalenyl-;9,10-Di(1-naphthyl)anthracene (purified by sublimation) | | CAS: | 26979-27-1 | | MF: | C34H22 | | MW: | 430.54 | | EINECS: | 1312995-182-4 | | Product Categories: | Electronic Chemicals | | Mol File: | 26979-27-1.mol |  |
| | 9,10-Di(1-naphthyl)anthracene Chemical Properties |
| Melting point | 360°C(lit.) | | Boiling point | 577.5±45.0 °C(Predicted) | | density | 1?+-.0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | λmax | 417nm(EtOH)(lit.) | | InChI | InChI=1S/C34H22/c1-3-15-25-23(11-1)13-9-21-27(25)33-29-17-5-7-19-31(29)34(32-20-8-6-18-30(32)33)28-22-10-14-24-12-2-4-16-26(24)28/h1-22H | | InChIKey | GWNJZSGBZMLRBW-UHFFFAOYSA-N | | SMILES | C1=C2C(C(C3=C4C(C=CC=C4)=CC=C3)=C3C(=C2C2=C4C(C=CC=C4)=CC=C2)C=CC=C3)=CC=C1 |
| | 9,10-Di(1-naphthyl)anthracene Usage And Synthesis |
| | 9,10-Di(1-naphthyl)anthracene Preparation Products And Raw materials |
|