|
|
| | 4-(3,4-Dichlorobenzyl)piperidine hydrochloride Basic information |
| | 4-(3,4-Dichlorobenzyl)piperidine hydrochloride Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C12H15Cl2N.ClH/c13-11-2-1-10(8-12(11)14)7-9-3-5-15-6-4-9;/h1-2,8-9,15H,3-7H2;1H | | InChIKey | QMXPLRLXVBJVNB-UHFFFAOYSA-N | | SMILES | ClC1=CC(CC2CCNCC2)=CC=C1Cl.Cl |
| WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
| | 4-(3,4-Dichlorobenzyl)piperidine hydrochloride Usage And Synthesis |
| | 4-(3,4-Dichlorobenzyl)piperidine hydrochloride Preparation Products And Raw materials |
|