|
|
| | 10-Oxo-10,11-Dihydro-5H-dibenz[b,f]azepine Basic information |
| Product Name: | 10-Oxo-10,11-Dihydro-5H-dibenz[b,f]azepine | | Synonyms: | 10-Oxo-10,11-Dihydro-5H-dibenz[b,f]azepine;5H-dibenzo[b,f]azepin-10(11H)-one;5,11-Dihydro-10H-dibenz[b,f]azepin-10-one;10H-Dibenz[b,f]azepin-10-one, 5,11-dihydro-;10-Keto-iMinodibenzyl;Oxcarbazepine Related CoMpound E;oxcarbazepine IMP;5,11-Dihydro-10H-dibenzo[b,f]azepin-10-one | | CAS: | 21737-58-6 | | MF: | C14H11NO | | MW: | 209.24 | | EINECS: | | | Product Categories: | Aromatics Compounds;Aromatics;Heterocycles | | Mol File: | 21737-58-6.mol | ![10-Oxo-10,11-Dihydro-5H-dibenz[b,f]azepine Structure](CAS/GIF/21737-58-6.gif) |
| | 10-Oxo-10,11-Dihydro-5H-dibenz[b,f]azepine Chemical Properties |
| Melting point | 138-140C | | Boiling point | 393.3±32.0 °C(Predicted) | | density | 1.186±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | -0.90±0.20(Predicted) | | form | Solid | | color | Yellow | | Major Application | pharmaceutical | | InChI | 1S/C14H11NO/c16-14-9-10-5-1-3-7-12(10)15-13-8-4-2-6-11(13)14/h1-8,15H,9H2 | | InChIKey | VSZGCLXGCOECAY-UHFFFAOYSA-N | | SMILES | N1c2c(cccc2)CC(=O)c3c1cccc3 | | CAS DataBase Reference | 21737-58-6 |
| WGK Germany | WGK 3 | | HS Code | 2933998350 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 10-Oxo-10,11-Dihydro-5H-dibenz[b,f]azepine Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | 10-Oxo-10,11-Dihydro-5H-dibenz[b,f]azepine (cas# 21737-58-6) is a compound useful in organic synthesis. | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 13, p. 979, 1970 DOI: 10.1021/jm00299a046 |
| | 10-Oxo-10,11-Dihydro-5H-dibenz[b,f]azepine Preparation Products And Raw materials |
| Raw materials | Ethanone, 1-(2-aminophenyl)-2-(2-bromophenyl)--->Benzenesulfonamide, N-[2-[2-(2-bromophenyl)acetyl]phenyl]-4-methyl--->10-Methoxyiminostilbene-->Oxcarbazepine-->5-Acetyl-5H-dibenzo[b,f]azepin-10(11H)-one-->5-Benzyl-10-oxo-10,11-dihydro-5H-dibenz[b,f]azepine-->Benzeneacetic acid, 2-[(methoxycarbonyl)phenylamino]-, methyl ester-->2-[(methoxycarbonyl)phenylamino]benzeneacetic acid-->Benzeneacetic acid, 2-(phenylamino)-, methyl ester-->10,11-Dihydro-10-oxo-5H-dibenzo[b,f]azepine-5-carboxylicacidMethylester-->1-Phenyloxindole-->Carbon-->o-Toluidine |
|