|
|
| | Hydroxy Pioglitazone (M-II) (Mixture of Diastereomers) Basic information |
| | Hydroxy Pioglitazone (M-II) (Mixture of Diastereomers) Chemical Properties |
| Melting point | 125-140 (sub) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Beige | | InChI | InChI=1S/C19H20N2O4S/c1-2-12-5-8-15(20-10-12)16(22)11-25-14-6-3-13(4-7-14)9-17-18(23)21-19(24)26-17/h3-8,10,16-17,22H,2,9,11H2,1H3,(H,21,23,24) | | InChIKey | RMTFRGFLVHAYCI-UHFFFAOYSA-N | | SMILES | S1C(CC2=CC=C(OCC(C3=NC=C(CC)C=C3)O)C=C2)C(=O)NC1=O |
| | Hydroxy Pioglitazone (M-II) (Mixture of Diastereomers) Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A metabolite of Pioglitazone (P471000). |
| | Hydroxy Pioglitazone (M-II) (Mixture of Diastereomers) Preparation Products And Raw materials |
|