|
|
| | 4-ACETAMIDO-2,2,6,6-TETRAMETHYLPIPERIDINE Basic information |
| Product Name: | 4-ACETAMIDO-2,2,6,6-TETRAMETHYLPIPERIDINE | | Synonyms: | 4-ACETAMIDO-2,2,6,6-TETRAMETHYLPIPERIDINE;LABOTEST-BB LT00012694;n-(2,2,6,6-tetramethyl-4-piperidinyl)-acetamid;4-Acetylamino-2,2,6,6-Tertramethylpiperidine;N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide;N-(2,2,6,6-Tetramethylpiperidin-4-yl)-acetamid;N-(2,2,6,6-Tetramethyl-4-piperidinyl)acetamide;Acetamide, N-(2,2,6,6-tetramethyl-4-piperidinyl)- | | CAS: | 40908-37-0 | | MF: | C11H22N2O | | MW: | 198.31 | | EINECS: | 255-137-0 | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Piperidines | | Mol File: | 40908-37-0.mol |  |
| | 4-ACETAMIDO-2,2,6,6-TETRAMETHYLPIPERIDINE Chemical Properties |
| Melting point | 102-104 °C (lit.) | | Boiling point | 161-163 °C/7 mmHg (lit.) | | density | 0.96 | | refractive index | 1.4620 (estimate) | | Fp | 121℃ | | pka | 16.01±0.60(Predicted) | | InChI | 1S/C11H22N2O/c1-8(14)12-9-6-10(2,3)13-11(4,5)7-9/h9,13H,6-7H2,1-5H3,(H,12,14) | | InChIKey | HVXYQAREJSKQNE-UHFFFAOYSA-N | | SMILES | CC(=O)NC1CC(C)(C)NC(C)(C)C1 | | EPA Substance Registry System | Acetamide, N-(2,2,6,6-tetramethyl-4-piperidinyl)- (40908-37-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-ACETAMIDO-2,2,6,6-TETRAMETHYLPIPERIDINE Usage And Synthesis |
| Uses | 4-Acetamido-2,2,6,6-tetramethylpiperidine is used in the preparation of antifungal selenium and sulfur derivatives of 2,2,6,6-tetramethylpiperidine. In addition it can be used as an antioxidant in the
oxoammonium-salt form. | | Uses | Reactant for synthesis of:
Selenium and sulfur derivatives with antifungal activity
Oxidants
Alpha and beta-glycosides
Reactant for reaction of nitroxyl radicals with metal carbonyls | | General Description | 4-Acetamido-2,2,6,6-tetramethylpiperidine is a piperidine derivative. Density of 4-acetamido-2,2,6,6-tetramethylpiperidine (N-(2,2,6,6-tetramethyl-4-piperidinyl)acetamide) has been reported. |
| | 4-ACETAMIDO-2,2,6,6-TETRAMETHYLPIPERIDINE Preparation Products And Raw materials |
|