|
|
| | 1H,1H,2H,2H-Perfluorooctyl acrylate Basic information |
| Product Name: | 1H,1H,2H,2H-Perfluorooctyl acrylate | | Synonyms: | 1H,1H,2H,2H-PERFLUOROOCTYL ACRYLATE;3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTYL ACRYLATE;1H,1H,2H,2H-Perfluorooctyl acrylate 95%;1H,1H,2H,2H-Perfluorooctylacrylate95%;2-(PERFLUOROHEXYL)ETHYL ACRYLATE;1,1,2,2-Tetrahydroperfluorooctylacrylate;2-Propenoicacid,3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylester;perfluorohexylethyl acrylate | | CAS: | 17527-29-6 | | MF: | C11H7F13O2 | | MW: | 418.15 | | EINECS: | 241-527-8 | | Product Categories: | monomer;Acrylic Monomers;Fluorinated AcrylicsSelf Assembly&Contact Printing;Fluorine-Containing Monomers for 157 nm UV Lithography Resist Polymers;Lithography Monomers;Monomers | | Mol File: | 17527-29-6.mol |  |
| | 1H,1H,2H,2H-Perfluorooctyl acrylate Chemical Properties |
| Boiling point | 76-80 °C8 mm Hg(lit.) | | density | 1.554 g/mL at 25 °C(lit.) | | vapor pressure | 2.59hPa at 25℃ | | refractive index | n20/D 1.338(lit.) | | Fp | 215 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Ethyl Acetate, Methanol (Slightly) | | form | Oil | | color | Colourless | | Specific Gravity | 1.554 | | Water Solubility | 185μg/L at 25℃ | | Stability: | Light Sensitive | | InChI | 1S/C11H7F13O2/c1-2-5(25)26-4-3-6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h2H,1,3-4H2 | | InChIKey | VPKQPPJQTZJZDB-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOC(=O)C=C | | LogP | 5.067 at 25℃ | | CAS DataBase Reference | 17527-29-6(CAS DataBase Reference) | | EPA Substance Registry System | 1,1,2,2-Tetrahydroperfluorooctyl acrylate (17527-29-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29037800 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 1 STOT RE 2 |
| | 1H,1H,2H,2H-Perfluorooctyl acrylate Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 1H,1H,2H,2H-Perfluorooctyl Acrylate is a semi-volatile fluorinated organic compound found in spring-time polluted Asian and western US air masses. |
| | 1H,1H,2H,2H-Perfluorooctyl acrylate Preparation Products And Raw materials |
|