- CBZ-L-Alanine
-
- $0.00 / 1Kg/Bag
-
2026-05-15
- CAS:1142-20-7
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
- Cbz-L-Ala-OH
-
- $0.00/ kg
-
2026-05-14
- CAS:1142-20-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | N-Carbobenzyloxy-L-alanine Basic information |
| | N-Carbobenzyloxy-L-alanine Chemical Properties |
| Melting point | 84-87 °C | | alpha | -15 º (c=2, AcOH 24 ºC) | | Boiling point | 364.51°C (rough estimate) | | density | 1.2446 (rough estimate) | | refractive index | -14.5 ° (C=2, AcOH) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 4.00±0.10(Predicted) | | form | Powder | | color | White | | Optical Rotation | [α]23/D 14.2°, c = 2 in acetic acid | | BRN | 2056164 | | Major Application | peptide synthesis | | InChI | InChI=1S/C11H13NO4/c1-8(10(13)14)12-11(15)16-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,15)(H,13,14)/t8-/m0/s1 | | InChIKey | TYRGLVWXHJRKMT-QMMMGPOBSA-N | | SMILES | C(O)(=O)[C@H](C)NC(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 1142-20-7(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 22-24/25-36-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | N-Carbobenzyloxy-L-alanine Usage And Synthesis |
| Chemical Properties | white powder | | Uses | N-Benzyloxycarbonyl-L-alanine is an intermediate in the synthesis of Perindopril (P287500), an angiotensin-converting enzyme (ACE) inhibitor. Antihypertensive. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-Carbobenzyloxy-L-alanine Preparation Products And Raw materials |
|