|
|
| | 1,1,2-TRICHLORO-2,3,3-TRIFLUOROCYCLOBUTANE Basic information |
| Product Name: | 1,1,2-TRICHLORO-2,3,3-TRIFLUOROCYCLOBUTANE | | Synonyms: | 2,3,3-TRIFLUORO-1,1,2-TRICHLORO CYCLOBUTANE;1,1,2-TRICHLORO-2,3,3-TRIFLUOROCYCLOBUTANE;1,1,2-Trifluoro-2,3,3-trichlorocyclobutane;1,2,2-Trifluoro-1,4,4-trichlorocyclobutane;1,1,2-Trichloro-2,3,3-trifluorocyclobutane 97%;1,1,2-Trichloro-2,3,3-trifluorocyclobutane97%;Cyclobutane, 1,1,2-trichloro-2,3,3-trifluoro-;1,1,2-TRICHLORO-2,3,3-TRIFLUOROCYCLOBUTANE ISO 9001:2015 REACH | | CAS: | 697-17-6 | | MF: | C4H2Cl3F3 | | MW: | 213.41 | | EINECS: | 211-804-8 | | Product Categories: | | | Mol File: | 697-17-6.mol |  |
| | 1,1,2-TRICHLORO-2,3,3-TRIFLUOROCYCLOBUTANE Chemical Properties |
| Boiling point | 120 °C(lit.) | | density | 1.594 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.416(lit.) | | Fp | 119-120°C | | Specific Gravity | 1.594 | | BRN | 1905850 | | InChI | 1S/C4H2Cl3F3/c5-2(6)1-3(8,9)4(2,7)10/h1H2 | | SMILES | ClC1(Cl)C(F)(Cl)C(F)(F)C1 | | CAS DataBase Reference | 697-17-6(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37 | | Safety Statements | 26-36 | | RIDADR | 2810 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29035980 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 STOT SE 3 |
| | 1,1,2-TRICHLORO-2,3,3-TRIFLUOROCYCLOBUTANE Usage And Synthesis |
| Chemical Properties | Clear colorless to pale yellow liquid |
| | 1,1,2-TRICHLORO-2,3,3-TRIFLUOROCYCLOBUTANE Preparation Products And Raw materials |
|