2-Propanol, 1-[4-[[2-(1-methylethoxy)ethoxy]methyl]phenoxy]-3-[(1-methylethyl)nitrosoamino]- manufacturers
- N-Nitroso Bisoprolol
-
-
2025-12-16
- CAS:2820170-76-9
- Min. Order: 10mg
- Purity: 99%+ HPLC
- Supply Ability: 1000
|
| | 2-Propanol, 1-[4-[[2-(1-methylethoxy)ethoxy]methyl]phenoxy]-3-[(1-methylethyl)nitrosoamino]- Basic information |
| | 2-Propanol, 1-[4-[[2-(1-methylethoxy)ethoxy]methyl]phenoxy]-3-[(1-methylethyl)nitrosoamino]- Chemical Properties |
| Boiling point | 514.3±50.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 13.19±0.20(Predicted) | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C18H30N2O5/c1-14(2)20(19-22)11-17(21)13-25-18-7-5-16(6-8-18)12-23-9-10-24-15(3)4/h5-8,14-15,17,21H,9-13H2,1-4H3 | | InChIKey | MEDUICQOPWENFS-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(COCCOC(C)C)C=C1)C(O)CN(C(C)C)N=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Propanol, 1-[4-[[2-(1-methylethoxy)ethoxy]methyl]phenoxy]-3-[(1-methylethyl)nitrosoamino]- Usage And Synthesis |
| Uses | These Reference Materials are suitable for use in several analytical applications including, but not limited to, method development for qualitative and quantitative analyses, daily calibration, and routine quality control testing. |
| | 2-Propanol, 1-[4-[[2-(1-methylethoxy)ethoxy]methyl]phenoxy]-3-[(1-methylethyl)nitrosoamino]- Preparation Products And Raw materials |
|