|
|
| | Methyl 1-(methylsulphonyl)piperidine-4-carboxylate Basic information |
| | Methyl 1-(methylsulphonyl)piperidine-4-carboxylate Chemical Properties |
| Melting point | 108~110℃ | | Boiling point | 320.3±52.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | -4.36±0.40(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C9H17NO4S/c1-3-14-9(11)8-4-6-10(7-5-8)15(2,12)13/h8H,3-7H2,1-2H3 | | InChIKey | ZEISHOJDDIABID-UHFFFAOYSA-N | | SMILES | O=C(C1CCN(S(=O)(C)=O)CC1)OCC |
| WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | Methyl 1-(methylsulphonyl)piperidine-4-carboxylate Usage And Synthesis |
| | Methyl 1-(methylsulphonyl)piperidine-4-carboxylate Preparation Products And Raw materials |
|