|
|
| | 2-Thiophenecarboxylicacid,3-fluoro-,methylester(9CI) Basic information |
| Product Name: | 2-Thiophenecarboxylicacid,3-fluoro-,methylester(9CI) | | Synonyms: | 2-Thiophenecarboxylicacid,3-fluoro-,methylester(9CI);Methyl 3-fluorothiophene-2-carboxylate;Methyl 3-fluoro-2-thiophenecarboxylate;3-Fluoro-thiophene-2-carboxylic acid Methyl ester;2-Thiophenecarboxylicacid,3-fluoro-,Methylester;3-Fluoro-2-thiophenecarboxylic acid methyl ester;3-Fluoro-thiophene-2;Methyl3-Fluoro-2-thiophenecarboxylate> | | CAS: | 100421-52-1 | | MF: | C6H5FO2S | | MW: | 160.17 | | EINECS: | | | Product Categories: | CARBOXYLICESTER | | Mol File: | 100421-52-1.mol |  |
| | 2-Thiophenecarboxylicacid,3-fluoro-,methylester(9CI) Chemical Properties |
| Melting point | 51-53℃ | | Boiling point | 217℃ | | density | 1.323 | | Fp | 85℃ | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C6H5FO2S/c1-9-6(8)5-4(7)2-3-10-5/h2-3H,1H3 | | InChIKey | UKIUEFZYSXIGPY-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)SC=CC=1F |
| | 2-Thiophenecarboxylicacid,3-fluoro-,methylester(9CI) Usage And Synthesis |
| Uses | Methyl 3-Fluorothiophene-2-carboxylate is used in preparation of of five membered heterocyclic compounds as STING agonists. |
| | 2-Thiophenecarboxylicacid,3-fluoro-,methylester(9CI) Preparation Products And Raw materials |
|